C17H27NO5 — CID 11141931
(2R,3S,4S)-3-hydroxy-N-methoxy-5-[(4-methoxyphenyl)methoxy]-N,2,4-trimethylpentanamide (PubChem CID 11141931) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is (2R,3S,4S)-3-hydroxy-N-methoxy-5-[(4-methoxyphenyl)methoxy]-N,2,4-trimethylpentanamide.
| Compound Name | (2R,3S,4S)-3-hydroxy-N-methoxy-5-[(4-methoxyphenyl)methoxy]-N,2,4-trimethylpentanamide |
|---|---|
| PubChem CID | 11141931 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | (2R,3S,4S)-3-hydroxy-N-methoxy-5-[(4-methoxyphenyl)methoxy]-N,2,4-trimethylpentanamide |
| SMILES | COc1ccc(COC[C@H](C)[C@H](O)[C@@H](C)C(=O)N(C)OC)cc1 |
| InChI | InChI=1S/C17H27NO5/c1-12(16(19)13(2)17(20)18(3)22-5)10-23-11-14-6-8-15(21-4)9-7-14/h6-9,12-13,16,19H,10-11H2,1-5H3/t12-,13+,16-/m0/s1 |
| InChIKey | MOGISFIDXHOYKQ-ZENOOKHLSA-N |
| XLogP | 1.86 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|