C23H32O4 — CID 11199606
(3aS,5aS,6S,9aR,9bR)-9a-hydroxy-6-[(4-methoxyphenyl)methoxy]-3a,5a-dimethyl-3,4,5,6,7,8,9,9b-octahydro-2H-cyclopenta[a]naphthalen-1-one (PubChem CID 11199606) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is (3aS,5aS,6S,9aR,9bR)-9a-hydroxy-6-[(4-methoxyphenyl)methoxy]-3a,5a-dimethyl-3,4,5,6,7,8,9,9b-octahydro-2H-cyclopenta[a]naphthalen-1-one.
| Compound Name | (3aS,5aS,6S,9aR,9bR)-9a-hydroxy-6-[(4-methoxyphenyl)methoxy]-3a,5a-dimethyl-3,4,5,6,7,8,9,9b-octahydro-2H-cyclopenta[a]naphthalen-1-one |
|---|---|
| PubChem CID | 11199606 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | (3aS,5aS,6S,9aR,9bR)-9a-hydroxy-6-[(4-methoxyphenyl)methoxy]-3a,5a-dimethyl-3,4,5,6,7,8,9,9b-octahydro-2H-cyclopenta[a]naphthalen-1-one |
| SMILES | COc1ccc(CO[C@H]2CCC[C@@]3(O)[C@@H]4C(=O)CC[C@]4(C)CC[C@@]23C)cc1 |
| InChI | InChI=1S/C23H32O4/c1-21-12-10-18(24)20(21)23(25)11-4-5-19(22(23,2)14-13-21)27-15-16-6-8-17(26-3)9-7-16/h6-9,19-20,25H,4-5,10-15H2,1-3H3/t19-,20+,21+,22-,23+/m0/s1 |
| InChIKey | YDLSTQOBVYZEAY-BVAFDOMYSA-N |
| XLogP | 4.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |