C29H56O4Si3 — CID 69221975
[2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methyl-4-phenylmethoxycyclohexyl]oxy-trimethylsilane (PubChem CID 69221975) has the molecular formula C29H56O4Si3 and a molecular weight of 553.02 g/mol. Its IUPAC name is [2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methyl-4-phenylmethoxycyclohexyl]oxy-trimethylsilane.
| Compound Name | [2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methyl-4-phenylmethoxycyclohexyl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 69221975 |
| Molecular Formula | C29H56O4Si3 |
| Molecular Weight | 553.02 g/mol |
| Exact Mass | 552.35 |
| IUPAC Name | [2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1-methyl-4-phenylmethoxycyclohexyl]oxy-trimethylsilane |
| SMILES | CC1(O[Si](C)(C)C)C(O[Si](C)(C)C(C)(C)C)CC(OCc2ccccc2)CC1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H56O4Si3/c1-27(2,3)35(11,12)31-25-20-24(30-22-23-18-16-15-17-19-23)21-26(29(25,7)33-34(8,9)10)32-36(13,14)28(4,5)6/h15-19,24-26H,20-22H2,1-14H3 |
| InChIKey | OEYQOPXLHKJPDZ-UHFFFAOYSA-N |
| XLogP | 8.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.02 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|