C25H40F2O2Si — CID 15724661
[(2R,3R,3aR,5R,6aS)-3-butyl-6,6-difluoro-5-phenylmethoxy-2,3,3a,4,5,6a-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 15724661) has the molecular formula C25H40F2O2Si and a molecular weight of 438.68 g/mol. Its IUPAC name is [(2R,3R,3aR,5R,6aS)-3-butyl-6,6-difluoro-5-phenylmethoxy-2,3,3a,4,5,6a-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2R,3R,3aR,5R,6aS)-3-butyl-6,6-difluoro-5-phenylmethoxy-2,3,3a,4,5,6a-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 15724661 |
| Molecular Formula | C25H40F2O2Si |
| Molecular Weight | 438.68 g/mol |
| Exact Mass | 438.28 |
| IUPAC Name | [(2R,3R,3aR,5R,6aS)-3-butyl-6,6-difluoro-5-phenylmethoxy-2,3,3a,4,5,6a-hexahydro-1H-pentalen-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCC[C@@H]1[C@H]2C[C@@H](OCc3ccccc3)C(F)(F)[C@H]2C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H40F2O2Si/c1-7-8-14-19-20-15-23(28-17-18-12-10-9-11-13-18)25(26,27)21(20)16-22(19)29-30(5,6)24(2,3)4/h9-13,19-23H,7-8,14-17H2,1-6H3/t19-,20-,21+,22-,23-/m1/s1 |
| InChIKey | FJKCZAVGYOZZQI-XNBWIAOKSA-N |
| XLogP | 7.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.68 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|