C27H49NOSi — CID 11362468
[(2S,3S,5R)-2-benzyl-1-methyl-5-nonylpyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11362468) has the molecular formula C27H49NOSi and a molecular weight of 431.78 g/mol. Its IUPAC name is [(2S,3S,5R)-2-benzyl-1-methyl-5-nonylpyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3S,5R)-2-benzyl-1-methyl-5-nonylpyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11362468 |
| Molecular Formula | C27H49NOSi |
| Molecular Weight | 431.78 g/mol |
| Exact Mass | 431.36 |
| IUPAC Name | [(2S,3S,5R)-2-benzyl-1-methyl-5-nonylpyrrolidin-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCCCCCCC[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](Cc2ccccc2)N1C |
| InChI | InChI=1S/C27H49NOSi/c1-8-9-10-11-12-13-17-20-24-22-26(29-30(6,7)27(2,3)4)25(28(24)5)21-23-18-15-14-16-19-23/h14-16,18-19,24-26H,8-13,17,20-22H2,1-7H3/t24-,25+,26+/m1/s1 |
| InChIKey | QEUOUIXZKLQVDV-ZNZIZOMTSA-N |
| XLogP | 7.83 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.78 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|