C41H57NO5Si — CID 11039665
benzyl (2S,3R,4R,5R)-3-benzoyloxy-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-5-nonylpyrrolidine-1-carboxylate (PubChem CID 11039665) has the molecular formula C41H57NO5Si and a molecular weight of 672.00 g/mol. Its IUPAC name is benzyl (2S,3R,4R,5R)-3-benzoyloxy-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-5-nonylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,3R,4R,5R)-3-benzoyloxy-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-5-nonylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11039665 |
| Molecular Formula | C41H57NO5Si |
| Molecular Weight | 672.00 g/mol |
| Exact Mass | 671.40 |
| IUPAC Name | benzyl (2S,3R,4R,5R)-3-benzoyloxy-2-benzyl-4-[tert-butyl(dimethyl)silyl]oxy-5-nonylpyrrolidine-1-carboxylate |
| SMILES | CCCCCCCCC[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC(=O)c2ccccc2)[C@H](Cc2ccccc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C41H57NO5Si/c1-7-8-9-10-11-12-22-29-35-38(47-48(5,6)41(2,3)4)37(46-39(43)34-27-20-15-21-28-34)36(30-32-23-16-13-17-24-32)42(35)40(44)45-31-33-25-18-14-19-26-33/h13-21,23-28,35-38H,7-12,22,29-31H2,1-6H3/t35-,36+,37-,38-/m1/s1 |
| InChIKey | PIZVZERIICTKBD-OQYJSAOUSA-N |
| XLogP | 10.38 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.00 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|