C24H37NO5Si — CID 11224661
1-O-benzyl 2-O-methyl (2S,3aS,6R,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate (PubChem CID 11224661) has the molecular formula C24H37NO5Si and a molecular weight of 447.65 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,3aS,6R,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,3aS,6R,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11224661 |
| Molecular Formula | C24H37NO5Si |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,3aS,6R,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,3,3a,4,5,6,7,7a-octahydroindole-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H37NO5Si/c1-24(2,3)31(5,6)30-19-13-12-18-14-21(22(26)28-4)25(20(18)15-19)23(27)29-16-17-10-8-7-9-11-17/h7-11,18-21H,12-16H2,1-6H3/t18-,19+,20-,21-/m0/s1 |
| InChIKey | YUOSIZJKZSLWDS-WOZUAGRISA-N |
| XLogP | 5.13 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|