C22H27NO4Si — CID 134969955
1-O-benzyl 2-O-methyl (2S,5R)-5-[dimethyl(phenyl)silyl]pyrrolidine-1,2-dicarboxylate (PubChem CID 134969955) has the molecular formula C22H27NO4Si and a molecular weight of 397.55 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,5R)-5-[dimethyl(phenyl)silyl]pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,5R)-5-[dimethyl(phenyl)silyl]pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 134969955 |
| Molecular Formula | C22H27NO4Si |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,5R)-5-[dimethyl(phenyl)silyl]pyrrolidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@@H]([Si](C)(C)c2ccccc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H27NO4Si/c1-26-21(24)19-14-15-20(28(2,3)18-12-8-5-9-13-18)23(19)22(25)27-16-17-10-6-4-7-11-17/h4-13,19-20H,14-16H2,1-3H3/t19-,20+/m0/s1 |
| InChIKey | OIHKMQLKSZYDIZ-VQTJNVASSA-N |
| XLogP | 3.48 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|