C27H30N2O5Si — CID 134969894
methyl (2S,5R)-5-[dimethyl(phenyl)silyl]-1-[(2S)-2-(1,3-dioxoisoindol-2-yl)pent-4-enoyl]pyrrolidine-2-carboxylate (PubChem CID 134969894) has the molecular formula C27H30N2O5Si and a molecular weight of 490.63 g/mol. Its IUPAC name is methyl (2S,5R)-5-[dimethyl(phenyl)silyl]-1-[(2S)-2-(1,3-dioxoisoindol-2-yl)pent-4-enoyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,5R)-5-[dimethyl(phenyl)silyl]-1-[(2S)-2-(1,3-dioxoisoindol-2-yl)pent-4-enoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 134969894 |
| Molecular Formula | C27H30N2O5Si |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | methyl (2S,5R)-5-[dimethyl(phenyl)silyl]-1-[(2S)-2-(1,3-dioxoisoindol-2-yl)pent-4-enoyl]pyrrolidine-2-carboxylate |
| SMILES | C=CC[C@@H](C(=O)N1[C@H]([Si](C)(C)c2ccccc2)CC[C@H]1C(=O)OC)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H30N2O5Si/c1-5-11-21(29-24(30)19-14-9-10-15-20(19)25(29)31)26(32)28-22(27(33)34-2)16-17-23(28)35(3,4)18-12-7-6-8-13-18/h5-10,12-15,21-23H,1,11,16-17H2,2-4H3/t21-,22-,23+/m0/s1 |
| InChIKey | DDMKYLGHEYTDQN-RJGXRXQPSA-N |
| XLogP | 2.91 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|