C26H39NO8Si — CID 10839731
1-O-benzyl 2-O-methyl (2S,7R,9R)-9-acetyloxy-7-[tert-butyl(dimethyl)silyl]oxy-4-oxoazonane-1,2-dicarboxylate (PubChem CID 10839731) has the molecular formula C26H39NO8Si and a molecular weight of 521.68 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,7R,9R)-9-acetyloxy-7-[tert-butyl(dimethyl)silyl]oxy-4-oxoazonane-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,7R,9R)-9-acetyloxy-7-[tert-butyl(dimethyl)silyl]oxy-4-oxoazonane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10839731 |
| Molecular Formula | C26H39NO8Si |
| Molecular Weight | 521.68 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,7R,9R)-9-acetyloxy-7-[tert-butyl(dimethyl)silyl]oxy-4-oxoazonane-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC(=O)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](OC(C)=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H39NO8Si/c1-18(28)34-23-16-21(35-36(6,7)26(2,3)4)14-13-20(29)15-22(24(30)32-5)27(23)25(31)33-17-19-11-9-8-10-12-19/h8-12,21-23H,13-17H2,1-7H3/t21-,22+,23-/m1/s1 |
| InChIKey | WXKWXSHGVAUJSW-XPWALMASSA-N |
| XLogP | 4.59 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.68 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|