C22H37NO2 — CID 102188992
(2S,3S,5R)-2-[(4-methoxyphenyl)methyl]-1-methyl-5-nonylpyrrolidin-3-ol (PubChem CID 102188992) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is (2S,3S,5R)-2-[(4-methoxyphenyl)methyl]-1-methyl-5-nonylpyrrolidin-3-ol.
| Compound Name | (2S,3S,5R)-2-[(4-methoxyphenyl)methyl]-1-methyl-5-nonylpyrrolidin-3-ol |
|---|---|
| PubChem CID | 102188992 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | (2S,3S,5R)-2-[(4-methoxyphenyl)methyl]-1-methyl-5-nonylpyrrolidin-3-ol |
| SMILES | CCCCCCCCC[C@@H]1C[C@H](O)[C@H](Cc2ccc(OC)cc2)N1C |
| InChI | InChI=1S/C22H37NO2/c1-4-5-6-7-8-9-10-11-19-17-22(24)21(23(19)2)16-18-12-14-20(25-3)15-13-18/h12-15,19,21-22,24H,4-11,16-17H2,1-3H3/t19-,21+,22+/m1/s1 |
| InChIKey | PUQKCEULCZCOEI-HJNYFJLDSA-N |
| XLogP | 4.81 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|