C25H40O4Si — CID 102168649
(7E,10S,12S)-10-[tert-butyl(dimethyl)silyl]oxy-12-methyl-5-phenylmethoxy-1-oxacyclododec-7-en-2-one (PubChem CID 102168649) has the molecular formula C25H40O4Si and a molecular weight of 432.68 g/mol. Its IUPAC name is (7E,10S,12S)-10-[tert-butyl(dimethyl)silyl]oxy-12-methyl-5-phenylmethoxy-1-oxacyclododec-7-en-2-one.
| Compound Name | (7E,10S,12S)-10-[tert-butyl(dimethyl)silyl]oxy-12-methyl-5-phenylmethoxy-1-oxacyclododec-7-en-2-one |
|---|---|
| PubChem CID | 102168649 |
| Molecular Formula | C25H40O4Si |
| Molecular Weight | 432.68 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | (7E,10S,12S)-10-[tert-butyl(dimethyl)silyl]oxy-12-methyl-5-phenylmethoxy-1-oxacyclododec-7-en-2-one |
| SMILES | C[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C/C=C/CC(OCc2ccccc2)CCC(=O)O1 |
| InChI | InChI=1S/C25H40O4Si/c1-20-18-23(29-30(5,6)25(2,3)4)15-11-10-14-22(16-17-24(26)28-20)27-19-21-12-8-7-9-13-21/h7-13,20,22-23H,14-19H2,1-6H3/b11-10+/t20-,22?,23-/m0/s1 |
| InChIKey | IVQMDKQNJLKFSG-ASLBVFGFSA-N |
| XLogP | 6.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.68 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|