C36H46O5Si — CID 135011475
(5S)-11-[tert-butyl(dimethyl)silyl]oxy-5-methyl-13,15-bis(phenylmethoxy)-4-oxabicyclo[10.4.0]hexadeca-1(12),8,13,15-tetraen-3-one (PubChem CID 135011475) has the molecular formula C36H46O5Si and a molecular weight of 586.85 g/mol. Its IUPAC name is (5S)-11-[tert-butyl(dimethyl)silyl]oxy-5-methyl-13,15-bis(phenylmethoxy)-4-oxabicyclo[10.4.0]hexadeca-1(12),8,13,15-tetraen-3-one.
| Compound Name | (5S)-11-[tert-butyl(dimethyl)silyl]oxy-5-methyl-13,15-bis(phenylmethoxy)-4-oxabicyclo[10.4.0]hexadeca-1(12),8,13,15-tetraen-3-one |
|---|---|
| PubChem CID | 135011475 |
| Molecular Formula | C36H46O5Si |
| Molecular Weight | 586.85 g/mol |
| Exact Mass | 586.31 |
| IUPAC Name | (5S)-11-[tert-butyl(dimethyl)silyl]oxy-5-methyl-13,15-bis(phenylmethoxy)-4-oxabicyclo[10.4.0]hexadeca-1(12),8,13,15-tetraen-3-one |
| SMILES | C[C@H]1CCC=CCC(O[Si](C)(C)C(C)(C)C)c2c(cc(OCc3ccccc3)cc2OCc2ccccc2)CC(=O)O1 |
| InChI | InChI=1S/C36H46O5Si/c1-27-16-10-7-15-21-32(41-42(5,6)36(2,3)4)35-30(23-34(37)40-27)22-31(38-25-28-17-11-8-12-18-28)24-33(35)39-26-29-19-13-9-14-20-29/h7-9,11-15,17-20,22,24,27,32H,10,16,21,23,25-26H2,1-6H3/t27-,32?/m0/s1 |
| InChIKey | HJYMYNGPFIHGQW-BSXJZHEVSA-N |
| XLogP | 9.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.85 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|