C30H30O5 — CID 135010835
(5S)-5-methyl-13,15-bis(phenylmethoxy)-4-oxabicyclo[10.4.0]hexadeca-1(12),8,13,15-tetraene-3,11-dione (PubChem CID 135010835) has the molecular formula C30H30O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is (5S)-5-methyl-13,15-bis(phenylmethoxy)-4-oxabicyclo[10.4.0]hexadeca-1(12),8,13,15-tetraene-3,11-dione.
| Compound Name | (5S)-5-methyl-13,15-bis(phenylmethoxy)-4-oxabicyclo[10.4.0]hexadeca-1(12),8,13,15-tetraene-3,11-dione |
|---|---|
| PubChem CID | 135010835 |
| Molecular Formula | C30H30O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | (5S)-5-methyl-13,15-bis(phenylmethoxy)-4-oxabicyclo[10.4.0]hexadeca-1(12),8,13,15-tetraene-3,11-dione |
| SMILES | C[C@H]1CCC=CCC(=O)c2c(cc(OCc3ccccc3)cc2OCc2ccccc2)CC(=O)O1 |
| InChI | InChI=1S/C30H30O5/c1-22-11-5-2-10-16-27(31)30-25(18-29(32)35-22)17-26(33-20-23-12-6-3-7-13-23)19-28(30)34-21-24-14-8-4-9-15-24/h2-4,6-10,12-15,17,19,22H,5,11,16,18,20-21H2,1H3/t22-/m0/s1 |
| InChIKey | QEMIPUBATMFLEE-QFIPXVFZSA-N |
| XLogP | 6.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|