C32H44N4O4Si — CID 71479712
(1S,3R,6S,7S,8S,9R)-3-azido-7-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methyl]-9-phenylmethoxy-5-azatricyclo[6.3.1.01,5]dodecan-4-one (PubChem CID 71479712) has the molecular formula C32H44N4O4Si and a molecular weight of 576.81 g/mol. Its IUPAC name is (1S,3R,6S,7S,8S,9R)-3-azido-7-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methyl]-9-phenylmethoxy-5-azatricyclo[6.3.1.01,5]dodecan-4-one.
| Compound Name | (1S,3R,6S,7S,8S,9R)-3-azido-7-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methyl]-9-phenylmethoxy-5-azatricyclo[6.3.1.01,5]dodecan-4-one |
|---|---|
| PubChem CID | 71479712 |
| Molecular Formula | C32H44N4O4Si |
| Molecular Weight | 576.81 g/mol |
| Exact Mass | 576.31 |
| IUPAC Name | (1S,3R,6S,7S,8S,9R)-3-azido-7-[tert-butyl(dimethyl)silyl]oxy-6-[(4-methoxyphenyl)methyl]-9-phenylmethoxy-5-azatricyclo[6.3.1.01,5]dodecan-4-one |
| SMILES | COc1ccc(C[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]3C[C@@]4(CC[C@H]3OCc3ccccc3)C[C@@H](N=[N+]=[N-])C(=O)N24)cc1 |
| InChI | InChI=1S/C32H44N4O4Si/c1-31(2,3)41(5,6)40-29-25-19-32(17-16-28(25)39-21-23-10-8-7-9-11-23)20-26(34-35-33)30(37)36(32)27(29)18-22-12-14-24(38-4)15-13-22/h7-15,25-29H,16-21H2,1-6H3/t25-,26+,27-,28+,29-,32-/m0/s1 |
| InChIKey | MOVMFSJLHODZTM-NMDZAHTOSA-N |
| XLogP | 7.05 |
| TPSA | 96.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.81 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|