C32H43N5O7SSi — CID 101343561
3-[(2S,3R,4R,5R,6R)-6-(azidomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dioxoisoindol-2-yl)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]sulfanyl-N-methylpropanamide (PubChem CID 101343561) has the molecular formula C32H43N5O7SSi and a molecular weight of 669.88 g/mol. Its IUPAC name is 3-[(2S,3R,4R,5R,6R)-6-(azidomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dioxoisoindol-2-yl)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]sulfanyl-N-methylpropanamide.
| Compound Name | 3-[(2S,3R,4R,5R,6R)-6-(azidomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dioxoisoindol-2-yl)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]sulfanyl-N-methylpropanamide |
|---|---|
| PubChem CID | 101343561 |
| Molecular Formula | C32H43N5O7SSi |
| Molecular Weight | 669.88 g/mol |
| Exact Mass | 669.27 |
| IUPAC Name | 3-[(2S,3R,4R,5R,6R)-6-(azidomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-3-(1,3-dioxoisoindol-2-yl)-5-[(4-methoxyphenyl)methoxy]oxan-2-yl]sulfanyl-N-methylpropanamide |
| SMILES | CNC(=O)CCS[C@@H]1O[C@H](CN=[N+]=[N-])[C@@H](OCc2ccc(OC)cc2)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C32H43N5O7SSi/c1-32(2,3)46(6,7)44-28-26(37-29(39)22-10-8-9-11-23(22)30(37)40)31(45-17-16-25(38)34-4)43-24(18-35-36-33)27(28)42-19-20-12-14-21(41-5)15-13-20/h8-15,24,26-28,31H,16-19H2,1-7H3,(H,34,38)/t24-,26-,27-,28-,31+/m1/s1 |
| InChIKey | WNCDWEHXVALBPR-LMVFQTSTSA-N |
| XLogP | 5.54 |
| TPSA | 152.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.88 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|