C29H47N5O7SSi — CID 101343563
prop-2-enyl N-[(2S,3R,4R,5R,6R)-6-(azidomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-2-[4-(methylamino)-4-oxobutyl]sulfanyloxan-3-yl]carbamate (PubChem CID 101343563) has the molecular formula C29H47N5O7SSi and a molecular weight of 637.88 g/mol. Its IUPAC name is prop-2-enyl N-[(2S,3R,4R,5R,6R)-6-(azidomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-2-[4-(methylamino)-4-oxobutyl]sulfanyloxan-3-yl]carbamate.
| Compound Name | prop-2-enyl N-[(2S,3R,4R,5R,6R)-6-(azidomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-2-[4-(methylamino)-4-oxobutyl]sulfanyloxan-3-yl]carbamate |
|---|---|
| PubChem CID | 101343563 |
| Molecular Formula | C29H47N5O7SSi |
| Molecular Weight | 637.88 g/mol |
| Exact Mass | 637.30 |
| IUPAC Name | prop-2-enyl N-[(2S,3R,4R,5R,6R)-6-(azidomethyl)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxy]-2-[4-(methylamino)-4-oxobutyl]sulfanyloxan-3-yl]carbamate |
| SMILES | C=CCOC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OCc2ccc(OC)cc2)[C@@H](CN=[N+]=[N-])O[C@H]1SCCCC(=O)NC |
| InChI | InChI=1S/C29H47N5O7SSi/c1-9-16-38-28(36)33-24-26(41-43(7,8)29(2,3)4)25(39-19-20-12-14-21(37-6)15-13-20)22(18-32-34-30)40-27(24)42-17-10-11-23(35)31-5/h9,12-15,22,24-27H,1,10-11,16-19H2,2-8H3,(H,31,35)(H,33,36)/t22-,24-,25-,26-,27+/m1/s1 |
| InChIKey | RGBTWXJMANBRBL-GDFOLFDLSA-N |
| XLogP | 5.55 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.88 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|