C26H35N7O10S — CID 24861969
[(2R,3R,4R,5S,6R)-2-(4-amino-4-oxobutyl)sulfanyl-6-(azidomethyl)-5-hydroxy-3-(prop-2-enoxycarbonylamino)oxan-4-yl] 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetate (PubChem CID 24861969) has the molecular formula C26H35N7O10S and a molecular weight of 637.67 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-2-(4-amino-4-oxobutyl)sulfanyl-6-(azidomethyl)-5-hydroxy-3-(prop-2-enoxycarbonylamino)oxan-4-yl] 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-2-(4-amino-4-oxobutyl)sulfanyl-6-(azidomethyl)-5-hydroxy-3-(prop-2-enoxycarbonylamino)oxan-4-yl] 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetate |
|---|---|
| PubChem CID | 24861969 |
| Molecular Formula | C26H35N7O10S |
| Molecular Weight | 637.67 g/mol |
| Exact Mass | 637.22 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-2-(4-amino-4-oxobutyl)sulfanyl-6-(azidomethyl)-5-hydroxy-3-(prop-2-enoxycarbonylamino)oxan-4-yl] 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetate |
| SMILES | C=CCOC(=O)N[C@@H]1[C@@H](OC(=O)CNC(=O)CNC(=O)OCc2ccccc2)[C@@H](O)[C@@H](CN=[N+]=[N-])O[C@@H]1SCCCC(N)=O |
| InChI | InChI=1S/C26H35N7O10S/c1-2-10-40-26(39)32-21-23(22(37)17(12-31-33-28)42-24(21)44-11-6-9-18(27)34)43-20(36)14-29-19(35)13-30-25(38)41-15-16-7-4-3-5-8-16/h2-5,7-8,17,21-24,37H,1,6,9-15H2,(H2,27,34)(H,29,35)(H,30,38)(H,32,39)/t17-,21-,22+,23-,24-/m1/s1 |
| InChIKey | RGIJKFKZCGPRCD-ASDZUOGYSA-N |
| XLogP | 0.62 |
| TPSA | 253.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.67 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|