C31H44F3N3O9SSi — CID 102355664
[(2R,3S,4R,5R,6S)-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4-phenylmethoxyoxan-2-yl]methyl 2,2,2-trifluoroethyl sulfate (PubChem CID 102355664) has the molecular formula C31H44F3N3O9SSi and a molecular weight of 719.85 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4-phenylmethoxyoxan-2-yl]methyl 2,2,2-trifluoroethyl sulfate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4-phenylmethoxyoxan-2-yl]methyl 2,2,2-trifluoroethyl sulfate |
|---|---|
| PubChem CID | 102355664 |
| Molecular Formula | C31H44F3N3O9SSi |
| Molecular Weight | 719.85 g/mol |
| Exact Mass | 719.25 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-4-phenylmethoxyoxan-2-yl]methyl 2,2,2-trifluoroethyl sulfate |
| SMILES | COc1ccc(CO[C@H]2[C@H](OCc3ccccc3)[C@@H](N=[N+]=[N-])[C@H](O[Si](C)(C)C(C)(C)C(C)C)O[C@@H]2COS(=O)(=O)OCC(F)(F)F)cc1 |
| InChI | InChI=1S/C31H44F3N3O9SSi/c1-21(2)30(3,4)48(6,7)46-29-26(36-37-35)28(42-17-22-11-9-8-10-12-22)27(41-18-23-13-15-24(40-5)16-14-23)25(45-29)19-43-47(38,39)44-20-31(32,33)34/h8-16,21,25-29H,17-20H2,1-7H3/t25-,26-,27-,28-,29+/m1/s1 |
| InChIKey | YVWJRPOFGBODAA-JPHCZMGXSA-N |
| XLogP | 7.07 |
| TPSA | 147.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.85 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|