C25H39N3O7Si — CID 146031549
[(2S,4R,5R)-3-azido-2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-6-(hydroxymethyl)-5-phenylmethoxyoxan-4-yl] prop-2-enyl carbonate (PubChem CID 146031549) has the molecular formula C25H39N3O7Si and a molecular weight of 521.69 g/mol. Its IUPAC name is [(2S,4R,5R)-3-azido-2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-6-(hydroxymethyl)-5-phenylmethoxyoxan-4-yl] prop-2-enyl carbonate.
| Compound Name | [(2S,4R,5R)-3-azido-2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-6-(hydroxymethyl)-5-phenylmethoxyoxan-4-yl] prop-2-enyl carbonate |
|---|---|
| PubChem CID | 146031549 |
| Molecular Formula | C25H39N3O7Si |
| Molecular Weight | 521.69 g/mol |
| Exact Mass | 521.26 |
| IUPAC Name | [(2S,4R,5R)-3-azido-2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-6-(hydroxymethyl)-5-phenylmethoxyoxan-4-yl] prop-2-enyl carbonate |
| SMILES | C=CCOC(=O)O[C@@H]1C(N=[N+]=[N-])[C@H](O[Si](C)(C)C(C)(C)C(C)C)OC(CO)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C25H39N3O7Si/c1-8-14-31-24(30)34-22-20(27-28-26)23(35-36(6,7)25(4,5)17(2)3)33-19(15-29)21(22)32-16-18-12-10-9-11-13-18/h8-13,17,19-23,29H,1,14-16H2,2-7H3/t19?,20?,21-,22+,23-/m0/s1 |
| InChIKey | PSETXHDNIWSRFY-HOIMLPCSSA-N |
| XLogP | 5.33 |
| TPSA | 132.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|