C23H37N3O6Si — CID 102167538
[(2R,3S,4R,5R,6S)-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-3-hydroxy-4-phenylmethoxyoxan-2-yl]methyl acetate (PubChem CID 102167538) has the molecular formula C23H37N3O6Si and a molecular weight of 479.65 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-3-hydroxy-4-phenylmethoxyoxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R,6S)-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-3-hydroxy-4-phenylmethoxyoxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 102167538 |
| Molecular Formula | C23H37N3O6Si |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-3-hydroxy-4-phenylmethoxyoxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](O[Si](C)(C)C(C)(C)C(C)C)[C@H](N=[N+]=[N-])[C@@H](OCc2ccccc2)[C@@H]1O |
| InChI | InChI=1S/C23H37N3O6Si/c1-15(2)23(4,5)33(6,7)32-22-19(25-26-24)21(30-13-17-11-9-8-10-12-17)20(28)18(31-22)14-29-16(3)27/h8-12,15,18-22,28H,13-14H2,1-7H3/t18-,19-,20-,21-,22+/m1/s1 |
| InChIKey | MRICYBJPBHXSBU-LMYCIYFBSA-N |
| XLogP | 4.56 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|