C32H53N3O6Si — CID 159704724
1-[(3S,4R,6R)-6-[(3S,4R,6S)-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-ethyl-4-methyloxan-3-yl]oxy-3,5-dimethyl-4-phenylmethoxyoxan-2-yl]ethanone (PubChem CID 159704724) has the molecular formula C32H53N3O6Si and a molecular weight of 603.88 g/mol. Its IUPAC name is 1-[(3S,4R,6R)-6-[(3S,4R,6S)-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-ethyl-4-methyloxan-3-yl]oxy-3,5-dimethyl-4-phenylmethoxyoxan-2-yl]ethanone.
| Compound Name | 1-[(3S,4R,6R)-6-[(3S,4R,6S)-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-ethyl-4-methyloxan-3-yl]oxy-3,5-dimethyl-4-phenylmethoxyoxan-2-yl]ethanone |
|---|---|
| PubChem CID | 159704724 |
| Molecular Formula | C32H53N3O6Si |
| Molecular Weight | 603.88 g/mol |
| Exact Mass | 603.37 |
| IUPAC Name | 1-[(3S,4R,6R)-6-[(3S,4R,6S)-5-azido-6-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-2-ethyl-4-methyloxan-3-yl]oxy-3,5-dimethyl-4-phenylmethoxyoxan-2-yl]ethanone |
| SMILES | CCC1O[C@@H](O[Si](C)(C)C(C)(C)C(C)C)C(N=[N+]=[N-])[C@@H](C)[C@@H]1O[C@@H]1OC(C(C)=O)[C@@H](C)[C@@H](OCc2ccccc2)C1C |
| InChI | InChI=1S/C32H53N3O6Si/c1-12-25-29(20(4)26(34-35-33)31(38-25)41-42(10,11)32(8,9)19(2)3)40-30-22(6)27(21(5)28(39-30)23(7)36)37-18-24-16-14-13-15-17-24/h13-17,19-22,25-31H,12,18H2,1-11H3/t20-,21+,22?,25?,26?,27-,28?,29+,30+,31+/m1/s1 |
| InChIKey | MYBHWLLKOAVLEK-VGBBOULXSA-N |
| XLogP | 7.65 |
| TPSA | 111.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.88 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|