C28H42N6O7 — CID 160877590
[(2R,4S,5S)-4-azido-6-ethyl-3,5-dimethyloxan-2-yl] acetate;[(2S,4S,5S)-4-azido-6-ethyl-5-methyl-3-phenylmethoxyoxan-2-yl] acetate (PubChem CID 160877590) has the molecular formula C28H42N6O7 and a molecular weight of 574.68 g/mol. Its IUPAC name is [(2R,4S,5S)-4-azido-6-ethyl-3,5-dimethyloxan-2-yl] acetate;[(2S,4S,5S)-4-azido-6-ethyl-5-methyl-3-phenylmethoxyoxan-2-yl] acetate.
| Compound Name | [(2R,4S,5S)-4-azido-6-ethyl-3,5-dimethyloxan-2-yl] acetate;[(2S,4S,5S)-4-azido-6-ethyl-5-methyl-3-phenylmethoxyoxan-2-yl] acetate |
|---|---|
| PubChem CID | 160877590 |
| Molecular Formula | C28H42N6O7 |
| Molecular Weight | 574.68 g/mol |
| Exact Mass | 574.31 |
| IUPAC Name | [(2R,4S,5S)-4-azido-6-ethyl-3,5-dimethyloxan-2-yl] acetate;[(2S,4S,5S)-4-azido-6-ethyl-5-methyl-3-phenylmethoxyoxan-2-yl] acetate |
| SMILES | CCC1O[C@@H](OC(C)=O)C(OCc2ccccc2)[C@@H](N=[N+]=[N-])[C@@H]1C.CCC1O[C@H](OC(C)=O)C(C)[C@@H](N=[N+]=[N-])[C@@H]1C |
| InChI | InChI=1S/C17H23N3O4.C11H19N3O3/c1-4-14-11(2)15(19-20-18)16(17(24-14)23-12(3)21)22-10-13-8-6-5-7-9-13;1-5-9-6(2)10(13-14-12)7(3)11(17-9)16-8(4)15/h5-9,11,14-17H,4,10H2,1-3H3;6-7,9-11H,5H2,1-4H3/t11-,14?,15+,16?,17-;6-,7?,9?,10+,11+/m11/s1 |
| InChIKey | SMPIEMDQKPSCHQ-AQILBOBISA-N |
| XLogP | 6.22 |
| TPSA | 177.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.68 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|