C23H26IN3O4 — CID 102192103
1-[(2S,3R,4S,5S,6S)-4-azido-6-(iodomethyl)-3,5-bis(phenylmethoxy)oxan-2-yl]propan-2-one (PubChem CID 102192103) has the molecular formula C23H26IN3O4 and a molecular weight of 535.38 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5S,6S)-4-azido-6-(iodomethyl)-3,5-bis(phenylmethoxy)oxan-2-yl]propan-2-one.
| Compound Name | 1-[(2S,3R,4S,5S,6S)-4-azido-6-(iodomethyl)-3,5-bis(phenylmethoxy)oxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 102192103 |
| Molecular Formula | C23H26IN3O4 |
| Molecular Weight | 535.38 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | 1-[(2S,3R,4S,5S,6S)-4-azido-6-(iodomethyl)-3,5-bis(phenylmethoxy)oxan-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1O[C@H](CI)[C@@H](OCc2ccccc2)[C@@H](N=[N+]=[N-])[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H26IN3O4/c1-16(28)12-19-22(29-14-17-8-4-2-5-9-17)21(26-27-25)23(20(13-24)31-19)30-15-18-10-6-3-7-11-18/h2-11,19-23H,12-15H2,1H3/t19-,20+,21-,22-,23+/m0/s1 |
| InChIKey | LYCMEXLJLLEKIT-MFKCLSPESA-N |
| XLogP | 5.02 |
| TPSA | 93.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.38 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|