C14H17IN3O3S- — CID 102598786
(2R,3R,4R,5S,6S)-3-azido-6-(iodomethyl)-5-methoxy-4-phenylmethoxyoxane-2-thiolate (PubChem CID 102598786) has the molecular formula C14H17IN3O3S- and a molecular weight of 434.28 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-3-azido-6-(iodomethyl)-5-methoxy-4-phenylmethoxyoxane-2-thiolate.
| Compound Name | (2R,3R,4R,5S,6S)-3-azido-6-(iodomethyl)-5-methoxy-4-phenylmethoxyoxane-2-thiolate |
|---|---|
| PubChem CID | 102598786 |
| Molecular Formula | C14H17IN3O3S- |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | (2R,3R,4R,5S,6S)-3-azido-6-(iodomethyl)-5-methoxy-4-phenylmethoxyoxane-2-thiolate |
| SMILES | CO[C@H]1[C@H](OCc2ccccc2)[C@@H](N=[N+]=[N-])[C@@H]([S-])O[C@@H]1CI |
| InChI | InChI=1S/C14H18IN3O3S/c1-19-12-10(7-15)21-14(22)11(17-18-16)13(12)20-8-9-5-3-2-4-6-9/h2-6,10-14,22H,7-8H2,1H3/p-1/t10-,11-,12-,13-,14-/m1/s1 |
| InChIKey | ANKMGYBLQACCJZ-DHGKCCLASA-M |
| XLogP | 2.97 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|