C28H34I2N6O7 — CID 102598788
(2S,3R,4R,5S,6S)-3-azido-2-[(2S,3S,4R,5R,6S)-5-azido-2-(iodomethyl)-6-methoxy-4-phenylmethoxyoxan-3-yl]oxy-6-(iodomethyl)-5-methoxy-4-phenylmethoxyoxane (PubChem CID 102598788) has the molecular formula C28H34I2N6O7 and a molecular weight of 820.42 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-3-azido-2-[(2S,3S,4R,5R,6S)-5-azido-2-(iodomethyl)-6-methoxy-4-phenylmethoxyoxan-3-yl]oxy-6-(iodomethyl)-5-methoxy-4-phenylmethoxyoxane.
| Compound Name | (2S,3R,4R,5S,6S)-3-azido-2-[(2S,3S,4R,5R,6S)-5-azido-2-(iodomethyl)-6-methoxy-4-phenylmethoxyoxan-3-yl]oxy-6-(iodomethyl)-5-methoxy-4-phenylmethoxyoxane |
|---|---|
| PubChem CID | 102598788 |
| Molecular Formula | C28H34I2N6O7 |
| Molecular Weight | 820.42 g/mol |
| Exact Mass | 820.06 |
| IUPAC Name | (2S,3R,4R,5S,6S)-3-azido-2-[(2S,3S,4R,5R,6S)-5-azido-2-(iodomethyl)-6-methoxy-4-phenylmethoxyoxan-3-yl]oxy-6-(iodomethyl)-5-methoxy-4-phenylmethoxyoxane |
| SMILES | CO[C@H]1O[C@H](CI)[C@@H](O[C@H]2O[C@H](CI)[C@@H](OC)[C@H](OCc3ccccc3)[C@H]2N=[N+]=[N-])[C@H](OCc2ccccc2)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C28H34I2N6O7/c1-37-23-19(13-29)42-28(22(34-36-32)25(23)39-15-17-9-5-3-6-10-17)43-24-20(14-30)41-27(38-2)21(33-35-31)26(24)40-16-18-11-7-4-8-12-18/h3-12,19-28H,13-16H2,1-2H3/t19-,20-,21-,22-,23-,24-,25-,26-,27+,28-/m1/s1 |
| InChIKey | ZTNQLYKVHFRANU-QLJCWTAQSA-N |
| XLogP | 5.88 |
| TPSA | 162.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.42 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|