C31H47N3O4Si — CID 56963707
[(1R,2S,3R,5S)-5-azido-2-[(4-methoxyphenyl)methoxy]-3-phenylmethoxycycloheptyl]oxy-tri(propan-2-yl)silane (PubChem CID 56963707) has the molecular formula C31H47N3O4Si and a molecular weight of 553.82 g/mol. Its IUPAC name is [(1R,2S,3R,5S)-5-azido-2-[(4-methoxyphenyl)methoxy]-3-phenylmethoxycycloheptyl]oxy-tri(propan-2-yl)silane.
| Compound Name | [(1R,2S,3R,5S)-5-azido-2-[(4-methoxyphenyl)methoxy]-3-phenylmethoxycycloheptyl]oxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 56963707 |
| Molecular Formula | C31H47N3O4Si |
| Molecular Weight | 553.82 g/mol |
| Exact Mass | 553.33 |
| IUPAC Name | [(1R,2S,3R,5S)-5-azido-2-[(4-methoxyphenyl)methoxy]-3-phenylmethoxycycloheptyl]oxy-tri(propan-2-yl)silane |
| SMILES | COc1ccc(CO[C@H]2[C@H](OCc3ccccc3)C[C@@H](N=[N+]=[N-])CC[C@H]2O[Si](C(C)C)(C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C31H47N3O4Si/c1-22(2)39(23(3)4,24(5)6)38-29-18-15-27(33-34-32)19-30(36-20-25-11-9-8-10-12-25)31(29)37-21-26-13-16-28(35-7)17-14-26/h8-14,16-17,22-24,27,29-31H,15,18-21H2,1-7H3/t27-,29+,30+,31+/m0/s1 |
| InChIKey | AXYHQAFIHSIYDU-OKNVFKEHSA-N |
| XLogP | 8.59 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.82 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|