C23H38O4Si — CID 25227644
(1R,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-[(4-methoxyphenyl)methoxymethyl]-4-methylcyclopentan-1-ol (PubChem CID 25227644) has the molecular formula C23H38O4Si and a molecular weight of 406.64 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-[(4-methoxyphenyl)methoxymethyl]-4-methylcyclopentan-1-ol.
| Compound Name | (1R,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-[(4-methoxyphenyl)methoxymethyl]-4-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 25227644 |
| Molecular Formula | C23H38O4Si |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | (1R,2S,3R,4S)-3-[tert-butyl(dimethyl)silyl]oxy-2-ethenyl-1-[(4-methoxyphenyl)methoxymethyl]-4-methylcyclopentan-1-ol |
| SMILES | C=C[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C[C@]1(O)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H38O4Si/c1-9-20-21(27-28(7,8)22(3,4)5)17(2)14-23(20,24)16-26-15-18-10-12-19(25-6)13-11-18/h9-13,17,20-21,24H,1,14-16H2,2-8H3/t17-,20-,21+,23-/m0/s1 |
| InChIKey | HZBPNCFEUJJNAC-JDLLUZBXSA-N |
| XLogP | 5.18 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|