C22H34O4Si — CID 25229280
(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxymethyl]-3-methylcyclopentene-1-carbaldehyde (PubChem CID 25229280) has the molecular formula C22H34O4Si and a molecular weight of 390.60 g/mol. Its IUPAC name is (3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxymethyl]-3-methylcyclopentene-1-carbaldehyde.
| Compound Name | (3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxymethyl]-3-methylcyclopentene-1-carbaldehyde |
|---|---|
| PubChem CID | 25229280 |
| Molecular Formula | C22H34O4Si |
| Molecular Weight | 390.60 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | (3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-5-[(4-methoxyphenyl)methoxymethyl]-3-methylcyclopentene-1-carbaldehyde |
| SMILES | COc1ccc(COC[C@@]2(O[Si](C)(C)C(C)(C)C)C[C@H](C)C=C2C=O)cc1 |
| InChI | InChI=1S/C22H34O4Si/c1-17-12-19(14-23)22(13-17,26-27(6,7)21(2,3)4)16-25-15-18-8-10-20(24-5)11-9-18/h8-12,14,17H,13,15-16H2,1-7H3/t17-,22+/m1/s1 |
| InChIKey | KSDDJLBFEZAKPN-VGSWGCGISA-N |
| XLogP | 5.14 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.60 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|