C23H34O5Si — CID 101211129
cis-(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-[(4-methoxyphenyl)methoxy]prop-1-enyl]cyclobutane-1,1-dicarbaldehyde (PubChem CID 101211129) has the molecular formula C23H34O5Si and a molecular weight of 418.61 g/mol. Its IUPAC name is cis-(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-[(4-methoxyphenyl)methoxy]prop-1-enyl]cyclobutane-1,1-dicarbaldehyde.
| Compound Name | cis-(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-[(4-methoxyphenyl)methoxy]prop-1-enyl]cyclobutane-1,1-dicarbaldehyde |
|---|---|
| PubChem CID | 101211129 |
| Molecular Formula | C23H34O5Si |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | cis-(2S,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(E)-3-[(4-methoxyphenyl)methoxy]prop-1-enyl]cyclobutane-1,1-dicarbaldehyde |
| SMILES | COc1ccc(COC/C=C/[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CC2(C=O)C=O)cc1 |
| InChI | InChI=1S/C23H34O5Si/c1-22(2,3)29(5,6)28-21-14-23(16-24,17-25)20(21)8-7-13-27-15-18-9-11-19(26-4)12-10-18/h7-12,16-17,20-21H,13-15H2,1-6H3/b8-7+/t20-,21+/m1/s1 |
| InChIKey | SSWJXNBJAQMZIL-YCQKYJJGSA-N |
| XLogP | 4.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|