C18H30O4Si — CID 11393604
tert-butyl-[(1R)-2-[(4-methoxyphenyl)methoxy]-1-[(2R)-oxiran-2-yl]ethoxy]-dimethylsilane (PubChem CID 11393604) has the molecular formula C18H30O4Si and a molecular weight of 338.52 g/mol. Its IUPAC name is tert-butyl-[(1R)-2-[(4-methoxyphenyl)methoxy]-1-[(2R)-oxiran-2-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R)-2-[(4-methoxyphenyl)methoxy]-1-[(2R)-oxiran-2-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11393604 |
| Molecular Formula | C18H30O4Si |
| Molecular Weight | 338.52 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | tert-butyl-[(1R)-2-[(4-methoxyphenyl)methoxy]-1-[(2R)-oxiran-2-yl]ethoxy]-dimethylsilane |
| SMILES | COc1ccc(COC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2CO2)cc1 |
| InChI | InChI=1S/C18H30O4Si/c1-18(2,3)23(5,6)22-17(16-13-21-16)12-20-11-14-7-9-15(19-4)10-8-14/h7-10,16-17H,11-13H2,1-6H3/t16-,17-/m1/s1 |
| InChIKey | SDKULJSRWSJWRD-IAGOWNOFSA-N |
| XLogP | 4.00 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.52 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|