C35H64O6Si2 — CID 102464243
(2R,3R,5Z,8S,9R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]ethyl]-9-ethyl-8-tri(propan-2-yl)silyloxy-2,3,4,7,8,9-hexahydrooxonin-3-ol (PubChem CID 102464243) has the molecular formula C35H64O6Si2 and a molecular weight of 637.06 g/mol. Its IUPAC name is (2R,3R,5Z,8S,9R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]ethyl]-9-ethyl-8-tri(propan-2-yl)silyloxy-2,3,4,7,8,9-hexahydrooxonin-3-ol.
| Compound Name | (2R,3R,5Z,8S,9R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]ethyl]-9-ethyl-8-tri(propan-2-yl)silyloxy-2,3,4,7,8,9-hexahydrooxonin-3-ol |
|---|---|
| PubChem CID | 102464243 |
| Molecular Formula | C35H64O6Si2 |
| Molecular Weight | 637.06 g/mol |
| Exact Mass | 636.42 |
| IUPAC Name | (2R,3R,5Z,8S,9R)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methoxy]ethyl]-9-ethyl-8-tri(propan-2-yl)silyloxy-2,3,4,7,8,9-hexahydrooxonin-3-ol |
| SMILES | CC[C@H]1O[C@@H]([C@@H](COCc2ccc(OC)cc2)O[Si](C)(C)C(C)(C)C)[C@H](O)C/C=C\C[C@@H]1O[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C35H64O6Si2/c1-14-31-32(41-43(25(2)3,26(4)5)27(6)7)18-16-15-17-30(36)34(39-31)33(40-42(12,13)35(8,9)10)24-38-23-28-19-21-29(37-11)22-20-28/h15-16,19-22,25-27,30-34,36H,14,17-18,23-24H2,1-13H3/b16-15-/t30-,31-,32+,33-,34-/m1/s1 |
| InChIKey | PKQAKWHBIOETMY-VISBFMGPSA-N |
| XLogP | 9.04 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.06 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|