C22H36O4Si — CID 132530227
(2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methoxymethyl]-3-methylhex-5-yn-1-ol (PubChem CID 132530227) has the molecular formula C22H36O4Si and a molecular weight of 392.61 g/mol. Its IUPAC name is (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methoxymethyl]-3-methylhex-5-yn-1-ol.
| Compound Name | (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methoxymethyl]-3-methylhex-5-yn-1-ol |
|---|---|
| PubChem CID | 132530227 |
| Molecular Formula | C22H36O4Si |
| Molecular Weight | 392.61 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-[(4-methoxyphenyl)methoxymethyl]-3-methylhex-5-yn-1-ol |
| SMILES | C#C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@@H](CO)COCc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H36O4Si/c1-9-21(26-27(7,8)22(3,4)5)17(2)19(14-23)16-25-15-18-10-12-20(24-6)13-11-18/h1,10-13,17,19,21,23H,14-16H2,2-8H3/t17-,19+,21+/m1/s1 |
| InChIKey | QDSGYPINHPFNFA-LMNJBCLMSA-N |
| XLogP | 4.48 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.61 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|