C29H42O5Si — CID 102278571
(3R,3aR,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-6a-[(4-methoxyphenyl)methoxymethyl]-3a-methyl-6'-methylidenespiro[5,6-dihydro-4H-cyclopenta[b]furan-3,3'-cyclohexene]-2-one (PubChem CID 102278571) has the molecular formula C29H42O5Si and a molecular weight of 498.74 g/mol. Its IUPAC name is (3R,3aR,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-6a-[(4-methoxyphenyl)methoxymethyl]-3a-methyl-6'-methylidenespiro[5,6-dihydro-4H-cyclopenta[b]furan-3,3'-cyclohexene]-2-one.
| Compound Name | (3R,3aR,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-6a-[(4-methoxyphenyl)methoxymethyl]-3a-methyl-6'-methylidenespiro[5,6-dihydro-4H-cyclopenta[b]furan-3,3'-cyclohexene]-2-one |
|---|---|
| PubChem CID | 102278571 |
| Molecular Formula | C29H42O5Si |
| Molecular Weight | 498.74 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | (3R,3aR,5R,6aR)-5-[tert-butyl(dimethyl)silyl]oxy-6a-[(4-methoxyphenyl)methoxymethyl]-3a-methyl-6'-methylidenespiro[5,6-dihydro-4H-cyclopenta[b]furan-3,3'-cyclohexene]-2-one |
| SMILES | C=C1C=C[C@@]2(CC1)C(=O)O[C@]1(COCc3ccc(OC)cc3)C[C@H](O[Si](C)(C)C(C)(C)C)C[C@@]12C |
| InChI | InChI=1S/C29H42O5Si/c1-21-13-15-28(16-14-21)25(30)33-29(20-32-19-22-9-11-23(31-6)12-10-22)18-24(17-27(28,29)5)34-35(7,8)26(2,3)4/h9-13,15,24H,1,14,16-20H2,2-8H3/t24-,27-,28-,29+/m1/s1 |
| InChIKey | ZTFFKEOFRPZXHD-XDOPXQJJSA-N |
| XLogP | 6.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.74 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|