C13H20O8 — CID 42643567
[(5S,7R,8R)-8-(methoxymethoxy)-2,2-dimethyl-6-oxo-1,3,10-trioxaspiro[4.5]decan-7-yl] acetate (PubChem CID 42643567) has the molecular formula C13H20O8 and a molecular weight of 304.30 g/mol. Its IUPAC name is [(5S,7R,8R)-8-(methoxymethoxy)-2,2-dimethyl-6-oxo-1,3,10-trioxaspiro[4.5]decan-7-yl] acetate.
| Compound Name | [(5S,7R,8R)-8-(methoxymethoxy)-2,2-dimethyl-6-oxo-1,3,10-trioxaspiro[4.5]decan-7-yl] acetate |
|---|---|
| PubChem CID | 42643567 |
| Molecular Formula | C13H20O8 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | [(5S,7R,8R)-8-(methoxymethoxy)-2,2-dimethyl-6-oxo-1,3,10-trioxaspiro[4.5]decan-7-yl] acetate |
| SMILES | COCO[C@@H]1CO[C@]2(COC(C)(C)O2)C(=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C13H20O8/c1-8(14)20-10-9(17-7-16-4)5-18-13(11(10)15)6-19-12(2,3)21-13/h9-10H,5-7H2,1-4H3/t9-,10-,13+/m1/s1 |
| InChIKey | HGYVECOYBCTHFA-BREBYQMCSA-N |
| XLogP | -0.01 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|