C18H34O7Si — CID 10318253
[(1R,4S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(methoxymethoxy)cyclopent-2-en-1-yl] acetate (PubChem CID 10318253) has the molecular formula C18H34O7Si and a molecular weight of 390.55 g/mol. Its IUPAC name is [(1R,4S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(methoxymethoxy)cyclopent-2-en-1-yl] acetate.
| Compound Name | [(1R,4S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(methoxymethoxy)cyclopent-2-en-1-yl] acetate |
|---|---|
| PubChem CID | 10318253 |
| Molecular Formula | C18H34O7Si |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | [(1R,4S,5R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4,5-bis(methoxymethoxy)cyclopent-2-en-1-yl] acetate |
| SMILES | COCO[C@@H]1[C@@H](OCOC)C=C(CO[Si](C)(C)C(C)(C)C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H34O7Si/c1-13(19)25-16-14(10-24-26(7,8)18(2,3)4)9-15(22-11-20-5)17(16)23-12-21-6/h9,15-17H,10-12H2,1-8H3/t15-,16+,17+/m0/s1 |
| InChIKey | FGQFLDZPMSHIQL-GVDBMIGSSA-N |
| XLogP | 2.86 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|