C15H27O3Si — CID 101122262
CID 101122262 (PubChem CID 101122262) has the molecular formula C15H27O3Si and a molecular weight of 283.46 g/mol.
| Compound Name | CID 101122262 |
|---|---|
| PubChem CID | 101122262 |
| Molecular Formula | C15H27O3Si |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | — |
| SMILES | CC(=O)O[C@H]1[CH][C@H]2C[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C15H27O3Si/c1-10(16)17-13-8-11-7-12(13)14(9-11)18-19(5,6)15(2,3)4/h8,11-14H,7,9H2,1-6H3/t11-,12+,13+,14+/m1/s1 |
| InChIKey | MIXKKQWPQYYQMP-RFGFWPKPSA-N |
| XLogP | 3.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|