C15H19BrO8 — CID 46915875
[(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-bromocyclohexen-1-yl]methyl acetate (PubChem CID 46915875) has the molecular formula C15H19BrO8 and a molecular weight of 407.21 g/mol. Its IUPAC name is [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-bromocyclohexen-1-yl]methyl acetate.
| Compound Name | [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-bromocyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 46915875 |
| Molecular Formula | C15H19BrO8 |
| Molecular Weight | 407.21 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | [(3R,4S,5R,6S)-3,4,6-triacetyloxy-5-bromocyclohexen-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](Br)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H19BrO8/c1-7(17)21-6-11-5-12(22-8(2)18)15(24-10(4)20)13(16)14(11)23-9(3)19/h5,12-15H,6H2,1-4H3/t12-,13-,14+,15+/m1/s1 |
| InChIKey | YZKBSQFAMUEBBN-KBXIAJHMSA-N |
| XLogP | 1.05 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|