C17H22O10 — CID 46915876
[(3R,4S,5S,6S)-3,4,5,6-tetraacetyloxycyclohexen-1-yl]methyl acetate (PubChem CID 46915876) has the molecular formula C17H22O10 and a molecular weight of 386.35 g/mol. Its IUPAC name is [(3R,4S,5S,6S)-3,4,5,6-tetraacetyloxycyclohexen-1-yl]methyl acetate.
| Compound Name | [(3R,4S,5S,6S)-3,4,5,6-tetraacetyloxycyclohexen-1-yl]methyl acetate |
|---|---|
| PubChem CID | 46915876 |
| Molecular Formula | C17H22O10 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | [(3R,4S,5S,6S)-3,4,5,6-tetraacetyloxycyclohexen-1-yl]methyl acetate |
| SMILES | CC(=O)OCC1=C[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C17H22O10/c1-8(18)23-7-13-6-14(24-9(2)19)16(26-11(4)21)17(27-12(5)22)15(13)25-10(3)20/h6,14-17H,7H2,1-5H3/t14-,15+,16+,17+/m1/s1 |
| InChIKey | NYFSBMUKENNJQN-QZWWFDLISA-N |
| XLogP | 0.22 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|