C16H20BrNO9 — CID 67722177
[(1S)-1,6,8-triacetyloxy-7-bromo-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-2-yl] acetate (PubChem CID 67722177) has the molecular formula C16H20BrNO9 and a molecular weight of 450.24 g/mol. Its IUPAC name is [(1S)-1,6,8-triacetyloxy-7-bromo-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-2-yl] acetate.
| Compound Name | [(1S)-1,6,8-triacetyloxy-7-bromo-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-2-yl] acetate |
|---|---|
| PubChem CID | 67722177 |
| Molecular Formula | C16H20BrNO9 |
| Molecular Weight | 450.24 g/mol |
| Exact Mass | 449.03 |
| IUPAC Name | [(1S)-1,6,8-triacetyloxy-7-bromo-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-2-yl] acetate |
| SMILES | CC(=O)OC1C(=O)N2CC(OC(C)=O)[C@@H](OC(C)=O)C2C(OC(C)=O)C1Br |
| InChI | InChI=1S/C16H20BrNO9/c1-6(19)24-10-5-18-12(13(10)25-7(2)20)14(26-8(3)21)11(17)15(16(18)23)27-9(4)22/h10-15H,5H2,1-4H3/t10?,11?,12?,13-,14?,15?/m1/s1 |
| InChIKey | CVIPDASRPYEPAK-DNKVGAQPSA-N |
| XLogP | -0.30 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.24 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|