C16H25NO8 — CID 67707828
[(1S,2R,8R,8aR)-1,8-diacetyloxy-7-ethoxy-5-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl] acetate (PubChem CID 67707828) has the molecular formula C16H25NO8 and a molecular weight of 359.38 g/mol. Its IUPAC name is [(1S,2R,8R,8aR)-1,8-diacetyloxy-7-ethoxy-5-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl] acetate.
| Compound Name | [(1S,2R,8R,8aR)-1,8-diacetyloxy-7-ethoxy-5-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl] acetate |
|---|---|
| PubChem CID | 67707828 |
| Molecular Formula | C16H25NO8 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | [(1S,2R,8R,8aR)-1,8-diacetyloxy-7-ethoxy-5-hydroxy-1,2,3,5,6,7,8,8a-octahydroindolizin-2-yl] acetate |
| SMILES | CCOC1CC(O)N2C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]2[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H25NO8/c1-5-22-11-6-13(21)17-7-12(23-8(2)18)16(25-10(4)20)14(17)15(11)24-9(3)19/h11-16,21H,5-7H2,1-4H3/t11?,12-,13?,14-,15+,16-/m1/s1 |
| InChIKey | PJSGZSHCTHPDAO-LXHWLFLBSA-N |
| XLogP | -0.41 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|