C11H18O6 — CID 102579609
[(1S,2S,3R,4S,5S,6S)-6-ethoxy-3,4-dihydroxy-8-oxabicyclo[3.2.1]octan-2-yl] acetate (PubChem CID 102579609) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is [(1S,2S,3R,4S,5S,6S)-6-ethoxy-3,4-dihydroxy-8-oxabicyclo[3.2.1]octan-2-yl] acetate.
| Compound Name | [(1S,2S,3R,4S,5S,6S)-6-ethoxy-3,4-dihydroxy-8-oxabicyclo[3.2.1]octan-2-yl] acetate |
|---|---|
| PubChem CID | 102579609 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | [(1S,2S,3R,4S,5S,6S)-6-ethoxy-3,4-dihydroxy-8-oxabicyclo[3.2.1]octan-2-yl] acetate |
| SMILES | CCO[C@H]1C[C@@H]2O[C@H]1[C@@H](O)[C@@H](O)[C@@H]2OC(C)=O |
| InChI | InChI=1S/C11H18O6/c1-3-15-6-4-7-11(16-5(2)12)9(14)8(13)10(6)17-7/h6-11,13-14H,3-4H2,1-2H3/t6-,7-,8-,9+,10+,11+/m0/s1 |
| InChIKey | IHQOMMVEHXUWAL-XBJGVBRDSA-N |
| XLogP | -0.78 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |