C15H20O8 — CID 102192106
[(2R,3S,4R,6S)-6-acetyl-3,4-diacetyloxy-8-oxabicyclo[3.2.1]octan-2-yl] acetate (PubChem CID 102192106) has the molecular formula C15H20O8 and a molecular weight of 328.32 g/mol. Its IUPAC name is [(2R,3S,4R,6S)-6-acetyl-3,4-diacetyloxy-8-oxabicyclo[3.2.1]octan-2-yl] acetate.
| Compound Name | [(2R,3S,4R,6S)-6-acetyl-3,4-diacetyloxy-8-oxabicyclo[3.2.1]octan-2-yl] acetate |
|---|---|
| PubChem CID | 102192106 |
| Molecular Formula | C15H20O8 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | [(2R,3S,4R,6S)-6-acetyl-3,4-diacetyloxy-8-oxabicyclo[3.2.1]octan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](OC(C)=O)C2C[C@H](C(C)=O)C(O2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C15H20O8/c1-6(16)10-5-11-13(20-7(2)17)15(22-9(4)19)14(12(10)23-11)21-8(3)18/h10-15H,5H2,1-4H3/t10-,11?,12?,13-,14-,15+/m1/s1 |
| InChIKey | MYQQXXFHJHPVFJ-HTYPPHOASA-N |
| XLogP | 0.16 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|