C14H18O10 — CID 170851468
[(1S,2S,3S,4R,5S)-3,4,7-triacetyloxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate (PubChem CID 170851468) has the molecular formula C14H18O10 and a molecular weight of 346.29 g/mol. Its IUPAC name is [(1S,2S,3S,4R,5S)-3,4,7-triacetyloxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate.
| Compound Name | [(1S,2S,3S,4R,5S)-3,4,7-triacetyloxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate |
|---|---|
| PubChem CID | 170851468 |
| Molecular Formula | C14H18O10 |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | [(1S,2S,3S,4R,5S)-3,4,7-triacetyloxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate |
| SMILES | CC(=O)OC1O[C@@H]2O[C@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O |
| InChI | InChI=1S/C14H18O10/c1-5(15)19-9-10(20-6(2)16)12-13(22-8(4)18)24-14(23-12)11(9)21-7(3)17/h9-14H,1-4H3/t9-,10-,11+,12-,13?,14-/m0/s1 |
| InChIKey | RKNVNFIFKOLYOD-JXXSAXMXSA-N |
| XLogP | -0.57 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|