C14H23NO5 — CID 23270670
[(1R,2S,6S)-2-(diacetylamino)-6-ethoxycyclohexyl] acetate (PubChem CID 23270670) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is [(1R,2S,6S)-2-(diacetylamino)-6-ethoxycyclohexyl] acetate.
| Compound Name | [(1R,2S,6S)-2-(diacetylamino)-6-ethoxycyclohexyl] acetate |
|---|---|
| PubChem CID | 23270670 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | [(1R,2S,6S)-2-(diacetylamino)-6-ethoxycyclohexyl] acetate |
| SMILES | CCO[C@H]1CCC[C@H](N(C(C)=O)C(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C14H23NO5/c1-5-19-13-8-6-7-12(14(13)20-11(4)18)15(9(2)16)10(3)17/h12-14H,5-8H2,1-4H3/t12-,13-,14+/m0/s1 |
| InChIKey | ONMHRKJNJXGHEL-MELADBBJSA-N |
| XLogP | 1.27 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |