C10H16ClNO2 — CID 13273722
N-acetyl-N-[(1R,2R)-2-chlorocyclohexyl]acetamide (PubChem CID 13273722) has the molecular formula C10H16ClNO2 and a molecular weight of 217.70 g/mol. Its IUPAC name is N-acetyl-N-[(1R,2R)-2-chlorocyclohexyl]acetamide.
| Compound Name | N-acetyl-N-[(1R,2R)-2-chlorocyclohexyl]acetamide |
|---|---|
| PubChem CID | 13273722 |
| Molecular Formula | C10H16ClNO2 |
| Molecular Weight | 217.70 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N-acetyl-N-[(1R,2R)-2-chlorocyclohexyl]acetamide |
| SMILES | CC(=O)N(C(C)=O)[C@@H]1CCCC[C@H]1Cl |
| InChI | InChI=1S/C10H16ClNO2/c1-7(13)12(8(2)14)10-6-4-3-5-9(10)11/h9-10H,3-6H2,1-2H3/t9-,10-/m1/s1 |
| InChIKey | CXRNSDAFXYVMSK-NXEZZACHSA-N |
| XLogP | 1.93 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.70 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|