About N-(2-chlorocyclohexyl)-N,4-dimethylpentanamide
N-(2-chlorocyclohexyl)-N,4-dimethylpentanamide (PubChem CID 102637926) has the molecular formula C13H24ClNO
and a molecular weight of 245.79 g/mol. Its IUPAC name is N-(2-chlorocyclohexyl)-N,4-dimethylpentanamide.
Molecular Properties
| Compound Name | N-(2-chlorocyclohexyl)-N,4-dimethylpentanamide |
| PubChem CID | 102637926 |
| Molecular Formula | C13H24ClNO |
| Molecular Weight | 245.79 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N-(2-chlorocyclohexyl)-N,4-dimethylpentanamide |
| SMILES | CC(C)CCC(=O)N(C)C1CCCCC1Cl |
| InChI | InChI=1S/C13H24ClNO/c1-10(2)8-9-13(16)15(3)12-7-5-4-6-11(12)14/h10-12H,4-9H2,1-3H3 |
| InChIKey | RZMZRLCEXNZPKL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.79 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(2-chlorocyclohexyl)-N,4-dimethylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorocyclohexyl)-N,4-dimethylpentanamide?
The IUPAC name of N-(2-chlorocyclohexyl)-N,4-dimethylpentanamide (CID 102637926) is N-(2-chlorocyclohexyl)-N,4-dimethylpentanamide.
What is the SMILES notation for N-(2-chlorocyclohexyl)-N,4-dimethylpentanamide?
The canonical SMILES for N-(2-chlorocyclohexyl)-N,4-dimethylpentanamide is CC(C)CCC(=O)N(C)C1CCCCC1Cl.
What is the InChIKey of N-(2-chlorocyclohexyl)-N,4-dimethylpentanamide?
The InChIKey is RZMZRLCEXNZPKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24ClNO/c1-10(2)8-9-13(16)15(3)12-7-5-4-6-11(12)14/h10-12H,4-9H2,1-3H3.
What are the key properties of N-(2-chlorocyclohexyl)-N,4-dimethylpentanamide?
N-(2-chlorocyclohexyl)-N,4-dimethylpentanamide has a molecular weight of 245.79 g/mol, XLogP of 3.43, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorocyclohexyl)-N,4-dimethylpentanamide is sourced from PubChem (CID 102637926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).