About potassium;2-ethoxycyclopentane-1-carboxylic acid;methanethiolate
potassium;2-ethoxycyclopentane-1-carboxylic acid;methanethiolate (PubChem CID 162751269) has the molecular formula C9H17KO3S
and a molecular weight of 244.40 g/mol. Its IUPAC name is potassium;2-ethoxycyclopentane-1-carboxylic acid;methanethiolate.
Molecular Properties
| Compound Name | potassium;2-ethoxycyclopentane-1-carboxylic acid;methanethiolate |
| PubChem CID | 162751269 |
| Molecular Formula | C9H17KO3S |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | potassium;2-ethoxycyclopentane-1-carboxylic acid;methanethiolate |
| SMILES | CCOC1CCCC1C(=O)O.C[S-].[K+] |
| InChI | InChI=1S/C8H14O3.CH4S.K/c1-2-11-7-5-3-4-6(7)8(9)10;1-2;/h6-7H,2-5H2,1H3,(H,9,10);2H,1H3;/q;;+1/p-1 |
| InChIKey | JGSDPXMJCVLSMN-UHFFFAOYSA-M |
| XLogP | -1.56 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze potassium;2-ethoxycyclopentane-1-carboxylic acid;methanethiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;2-ethoxycyclopentane-1-carboxylic acid;methanethiolate?
The IUPAC name of potassium;2-ethoxycyclopentane-1-carboxylic acid;methanethiolate (CID 162751269) is potassium;2-ethoxycyclopentane-1-carboxylic acid;methanethiolate.
What is the SMILES notation for potassium;2-ethoxycyclopentane-1-carboxylic acid;methanethiolate?
The canonical SMILES for potassium;2-ethoxycyclopentane-1-carboxylic acid;methanethiolate is CCOC1CCCC1C(=O)O.C[S-].[K+].
What is the InChIKey of potassium;2-ethoxycyclopentane-1-carboxylic acid;methanethiolate?
The InChIKey is JGSDPXMJCVLSMN-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H14O3.CH4S.K/c1-2-11-7-5-3-4-6(7)8(9)10;1-2;/h6-7H,2-5H2,1H3,(H,9,10);2H,1H3;/q;;+1/p-1.
What are the key properties of potassium;2-ethoxycyclopentane-1-carboxylic acid;methanethiolate?
potassium;2-ethoxycyclopentane-1-carboxylic acid;methanethiolate has a molecular weight of 244.40 g/mol, XLogP of -1.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;2-ethoxycyclopentane-1-carboxylic acid;methanethiolate is sourced from PubChem (CID 162751269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).