C11H18O3 — CID 125482695
(1R,3aS,4S,6aS)-4-ethoxy-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxylic acid (PubChem CID 125482695) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (1R,3aS,4S,6aS)-4-ethoxy-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxylic acid.
| Compound Name | (1R,3aS,4S,6aS)-4-ethoxy-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxylic acid |
|---|---|
| PubChem CID | 125482695 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (1R,3aS,4S,6aS)-4-ethoxy-1,2,3,3a,4,5,6,6a-octahydropentalene-1-carboxylic acid |
| SMILES | CCO[C@H]1CC[C@H]2[C@@H]1CC[C@H]2C(=O)O |
| InChI | InChI=1S/C11H18O3/c1-2-14-10-6-5-7-8(10)3-4-9(7)11(12)13/h7-10H,2-6H2,1H3,(H,12,13)/t7-,8-,9+,10-/m0/s1 |
| InChIKey | QURKLCVTFGXQBW-QEYWKRMJSA-N |
| XLogP | 1.91 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |