C17H23NO8 — CID 132917047
[(3R,4R,5R,6R)-4,5,6-triacetyloxy-1-prop-2-ynylazepan-3-yl] acetate (PubChem CID 132917047) has the molecular formula C17H23NO8 and a molecular weight of 369.37 g/mol. Its IUPAC name is [(3R,4R,5R,6R)-4,5,6-triacetyloxy-1-prop-2-ynylazepan-3-yl] acetate.
| Compound Name | [(3R,4R,5R,6R)-4,5,6-triacetyloxy-1-prop-2-ynylazepan-3-yl] acetate |
|---|---|
| PubChem CID | 132917047 |
| Molecular Formula | C17H23NO8 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | [(3R,4R,5R,6R)-4,5,6-triacetyloxy-1-prop-2-ynylazepan-3-yl] acetate |
| SMILES | C#CCN1C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C17H23NO8/c1-6-7-18-8-14(23-10(2)19)16(25-12(4)21)17(26-13(5)22)15(9-18)24-11(3)20/h1,14-17H,7-9H2,2-5H3/t14-,15-,16-,17-/m1/s1 |
| InChIKey | DZJDLWYLTUXYIZ-QBPKDAKJSA-N |
| XLogP | -0.34 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|